C17H21FN4O3S — CID 19285254
N-[1-[(4-fluorophenyl)methyl]pyrazol-3-yl]-1-methylsulfonylpiperidine-4-carboxamide (PubChem CID 19285254) has the molecular formula C17H21FN4O3S and a molecular weight of 380.45 g/mol. Its IUPAC name is N-[1-[(4-fluorophenyl)methyl]pyrazol-3-yl]-1-methylsulfonylpiperidine-4-carboxamide.
| Compound Name | N-[1-[(4-fluorophenyl)methyl]pyrazol-3-yl]-1-methylsulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 19285254 |
| Molecular Formula | C17H21FN4O3S |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | N-[1-[(4-fluorophenyl)methyl]pyrazol-3-yl]-1-methylsulfonylpiperidine-4-carboxamide |
| SMILES | CS(=O)(=O)N1CCC(C(=O)Nc2ccn(Cc3ccc(F)cc3)n2)CC1 |
| InChI | InChI=1S/C17H21FN4O3S/c1-26(24,25)22-10-6-14(7-11-22)17(23)19-16-8-9-21(20-16)12-13-2-4-15(18)5-3-13/h2-5,8-9,14H,6-7,10-12H2,1H3,(H,19,20,23) |
| InChIKey | UJVZOUYGTQVMOE-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |