C19H25N3O4 — CID 120524856
2-[3-methyl-4-[(5-methyl-1-pentan-3-ylpyrazole-4-carbonyl)amino]phenoxy]acetic acid (PubChem CID 120524856) has the molecular formula C19H25N3O4 and a molecular weight of 359.43 g/mol. Its IUPAC name is 2-[3-methyl-4-[(5-methyl-1-pentan-3-ylpyrazole-4-carbonyl)amino]phenoxy]acetic acid.
| Compound Name | 2-[3-methyl-4-[(5-methyl-1-pentan-3-ylpyrazole-4-carbonyl)amino]phenoxy]acetic acid |
|---|---|
| PubChem CID | 120524856 |
| Molecular Formula | C19H25N3O4 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | 2-[3-methyl-4-[(5-methyl-1-pentan-3-ylpyrazole-4-carbonyl)amino]phenoxy]acetic acid |
| SMILES | CCC(CC)n1ncc(C(=O)Nc2ccc(OCC(=O)O)cc2C)c1C |
| InChI | InChI=1S/C19H25N3O4/c1-5-14(6-2)22-13(4)16(10-20-22)19(25)21-17-8-7-15(9-12(17)3)26-11-18(23)24/h7-10,14H,5-6,11H2,1-4H3,(H,21,25)(H,23,24) |
| InChIKey | MWXSDMFJOZQOLH-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |