C19H22N2O4 — CID 120525344
5-[(2-cyclopropyl-6-methoxyquinoline-4-carbonyl)amino]pentanoic acid (PubChem CID 120525344) has the molecular formula C19H22N2O4 and a molecular weight of 342.40 g/mol. Its IUPAC name is 5-[(2-cyclopropyl-6-methoxyquinoline-4-carbonyl)amino]pentanoic acid.
| Compound Name | 5-[(2-cyclopropyl-6-methoxyquinoline-4-carbonyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 120525344 |
| Molecular Formula | C19H22N2O4 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | 5-[(2-cyclopropyl-6-methoxyquinoline-4-carbonyl)amino]pentanoic acid |
| SMILES | COc1ccc2nc(C3CC3)cc(C(=O)NCCCCC(=O)O)c2c1 |
| InChI | InChI=1S/C19H22N2O4/c1-25-13-7-8-16-14(10-13)15(11-17(21-16)12-5-6-12)19(24)20-9-3-2-4-18(22)23/h7-8,10-12H,2-6,9H2,1H3,(H,20,24)(H,22,23) |
| InChIKey | WVUOLIDDOFRRFI-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|