C14H17F2NO4S — CID 120526528
2-[2-[[2-(2-ethoxyphenyl)-2,2-difluoroacetyl]amino]ethylsulfanyl]acetic acid (PubChem CID 120526528) has the molecular formula C14H17F2NO4S and a molecular weight of 333.36 g/mol. Its IUPAC name is 2-[2-[[2-(2-ethoxyphenyl)-2,2-difluoroacetyl]amino]ethylsulfanyl]acetic acid.
| Compound Name | 2-[2-[[2-(2-ethoxyphenyl)-2,2-difluoroacetyl]amino]ethylsulfanyl]acetic acid |
|---|---|
| PubChem CID | 120526528 |
| Molecular Formula | C14H17F2NO4S |
| Molecular Weight | 333.36 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | 2-[2-[[2-(2-ethoxyphenyl)-2,2-difluoroacetyl]amino]ethylsulfanyl]acetic acid |
| SMILES | CCOc1ccccc1C(F)(F)C(=O)NCCSCC(=O)O |
| InChI | InChI=1S/C14H17F2NO4S/c1-2-21-11-6-4-3-5-10(11)14(15,16)13(20)17-7-8-22-9-12(18)19/h3-6H,2,7-9H2,1H3,(H,17,20)(H,18,19) |
| InChIKey | UFMIRZGSNFIJFB-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.36 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|