C14H17F2NO4 — CID 120519752
2-[[2-(2-ethoxyphenyl)-2,2-difluoroacetyl]-ethylamino]acetic acid (PubChem CID 120519752) has the molecular formula C14H17F2NO4 and a molecular weight of 301.29 g/mol. Its IUPAC name is 2-[[2-(2-ethoxyphenyl)-2,2-difluoroacetyl]-ethylamino]acetic acid.
| Compound Name | 2-[[2-(2-ethoxyphenyl)-2,2-difluoroacetyl]-ethylamino]acetic acid |
|---|---|
| PubChem CID | 120519752 |
| Molecular Formula | C14H17F2NO4 |
| Molecular Weight | 301.29 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | 2-[[2-(2-ethoxyphenyl)-2,2-difluoroacetyl]-ethylamino]acetic acid |
| SMILES | CCOc1ccccc1C(F)(F)C(=O)N(CC)CC(=O)O |
| InChI | InChI=1S/C14H17F2NO4/c1-3-17(9-12(18)19)13(20)14(15,16)10-7-5-6-8-11(10)21-4-2/h5-8H,3-4,9H2,1-2H3,(H,18,19) |
| InChIKey | ZMMBMWOYCPRYAJ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.29 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |