C20H22N2O5 — CID 120527790
2-[4-[2-[3-(pyridin-3-ylmethoxy)phenyl]acetyl]morpholin-2-yl]acetic acid (PubChem CID 120527790) has the molecular formula C20H22N2O5 and a molecular weight of 370.41 g/mol. Its IUPAC name is 2-[4-[2-[3-(pyridin-3-ylmethoxy)phenyl]acetyl]morpholin-2-yl]acetic acid.
| Compound Name | 2-[4-[2-[3-(pyridin-3-ylmethoxy)phenyl]acetyl]morpholin-2-yl]acetic acid |
|---|---|
| PubChem CID | 120527790 |
| Molecular Formula | C20H22N2O5 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | 2-[4-[2-[3-(pyridin-3-ylmethoxy)phenyl]acetyl]morpholin-2-yl]acetic acid |
| SMILES | O=C(O)CC1CN(C(=O)Cc2cccc(OCc3cccnc3)c2)CCO1 |
| InChI | InChI=1S/C20H22N2O5/c23-19(22-7-8-26-18(13-22)11-20(24)25)10-15-3-1-5-17(9-15)27-14-16-4-2-6-21-12-16/h1-6,9,12,18H,7-8,10-11,13-14H2,(H,24,25) |
| InChIKey | BJIOTJFETIZFEA-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 88.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |