C14H19N3O6S — CID 120527570
2-[4-[2-[methyl(pyridin-3-ylsulfonyl)amino]acetyl]morpholin-2-yl]acetic acid (PubChem CID 120527570) has the molecular formula C14H19N3O6S and a molecular weight of 357.39 g/mol. Its IUPAC name is 2-[4-[2-[methyl(pyridin-3-ylsulfonyl)amino]acetyl]morpholin-2-yl]acetic acid.
| Compound Name | 2-[4-[2-[methyl(pyridin-3-ylsulfonyl)amino]acetyl]morpholin-2-yl]acetic acid |
|---|---|
| PubChem CID | 120527570 |
| Molecular Formula | C14H19N3O6S |
| Molecular Weight | 357.39 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | 2-[4-[2-[methyl(pyridin-3-ylsulfonyl)amino]acetyl]morpholin-2-yl]acetic acid |
| SMILES | CN(CC(=O)N1CCOC(CC(=O)O)C1)S(=O)(=O)c1cccnc1 |
| InChI | InChI=1S/C14H19N3O6S/c1-16(24(21,22)12-3-2-4-15-8-12)10-13(18)17-5-6-23-11(9-17)7-14(19)20/h2-4,8,11H,5-7,9-10H2,1H3,(H,19,20) |
| InChIKey | NTUYUIYBSFZJAC-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 117.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.39 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |