C16H24N4O4S — CID 49050534
N-ethyl-1-[2-[methyl(pyridin-3-ylsulfonyl)amino]acetyl]piperidine-3-carboxamide (PubChem CID 49050534) has the molecular formula C16H24N4O4S and a molecular weight of 368.46 g/mol. Its IUPAC name is N-ethyl-1-[2-[methyl(pyridin-3-ylsulfonyl)amino]acetyl]piperidine-3-carboxamide.
| Compound Name | N-ethyl-1-[2-[methyl(pyridin-3-ylsulfonyl)amino]acetyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 49050534 |
| Molecular Formula | C16H24N4O4S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | N-ethyl-1-[2-[methyl(pyridin-3-ylsulfonyl)amino]acetyl]piperidine-3-carboxamide |
| SMILES | CCNC(=O)C1CCCN(C(=O)CN(C)S(=O)(=O)c2cccnc2)C1 |
| InChI | InChI=1S/C16H24N4O4S/c1-3-18-16(22)13-6-5-9-20(11-13)15(21)12-19(2)25(23,24)14-7-4-8-17-10-14/h4,7-8,10,13H,3,5-6,9,11-12H2,1-2H3,(H,18,22) |
| InChIKey | RGSOGEZSGLXODO-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 99.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |