C16H22N2O6S — CID 120528098
4-hydroxy-1-[2-(propylsulfonylamino)benzoyl]piperidine-4-carboxylic acid (PubChem CID 120528098) has the molecular formula C16H22N2O6S and a molecular weight of 370.43 g/mol. Its IUPAC name is 4-hydroxy-1-[2-(propylsulfonylamino)benzoyl]piperidine-4-carboxylic acid.
| Compound Name | 4-hydroxy-1-[2-(propylsulfonylamino)benzoyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 120528098 |
| Molecular Formula | C16H22N2O6S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | 4-hydroxy-1-[2-(propylsulfonylamino)benzoyl]piperidine-4-carboxylic acid |
| SMILES | CCCS(=O)(=O)Nc1ccccc1C(=O)N1CCC(O)(C(=O)O)CC1 |
| InChI | InChI=1S/C16H22N2O6S/c1-2-11-25(23,24)17-13-6-4-3-5-12(13)14(19)18-9-7-16(22,8-10-18)15(20)21/h3-6,17,22H,2,7-11H2,1H3,(H,20,21) |
| InChIKey | JZQKKTVKJVMOAN-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |