C17H18ClN3O4 — CID 120528269
1-[1-(2-chlorophenyl)-5-methylpyrazole-3-carbonyl]-4-hydroxypiperidine-4-carboxylic acid (PubChem CID 120528269) has the molecular formula C17H18ClN3O4 and a molecular weight of 363.80 g/mol. Its IUPAC name is 1-[1-(2-chlorophenyl)-5-methylpyrazole-3-carbonyl]-4-hydroxypiperidine-4-carboxylic acid.
| Compound Name | 1-[1-(2-chlorophenyl)-5-methylpyrazole-3-carbonyl]-4-hydroxypiperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 120528269 |
| Molecular Formula | C17H18ClN3O4 |
| Molecular Weight | 363.80 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | 1-[1-(2-chlorophenyl)-5-methylpyrazole-3-carbonyl]-4-hydroxypiperidine-4-carboxylic acid |
| SMILES | Cc1cc(C(=O)N2CCC(O)(C(=O)O)CC2)nn1-c1ccccc1Cl |
| InChI | InChI=1S/C17H18ClN3O4/c1-11-10-13(19-21(11)14-5-3-2-4-12(14)18)15(22)20-8-6-17(25,7-9-20)16(23)24/h2-5,10,25H,6-9H2,1H3,(H,23,24) |
| InChIKey | GJZWTQASJYYWJF-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.80 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |