C17H20N2O3S — CID 120528347
3-[4-[4-(2-methyl-1,3-thiazol-4-yl)butanoylamino]phenyl]propanoic acid (PubChem CID 120528347) has the molecular formula C17H20N2O3S and a molecular weight of 332.43 g/mol. Its IUPAC name is 3-[4-[4-(2-methyl-1,3-thiazol-4-yl)butanoylamino]phenyl]propanoic acid.
| Compound Name | 3-[4-[4-(2-methyl-1,3-thiazol-4-yl)butanoylamino]phenyl]propanoic acid |
|---|---|
| PubChem CID | 120528347 |
| Molecular Formula | C17H20N2O3S |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | 3-[4-[4-(2-methyl-1,3-thiazol-4-yl)butanoylamino]phenyl]propanoic acid |
| SMILES | Cc1nc(CCCC(=O)Nc2ccc(CCC(=O)O)cc2)cs1 |
| InChI | InChI=1S/C17H20N2O3S/c1-12-18-15(11-23-12)3-2-4-16(20)19-14-8-5-13(6-9-14)7-10-17(21)22/h5-6,8-9,11H,2-4,7,10H2,1H3,(H,19,20)(H,21,22) |
| InChIKey | KNSHVVGWNWLKDQ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |