C15H19NO3S2 — CID 120528850
3-[[2-(1,4-dithian-2-yl)acetyl]amino]-2-phenylpropanoic acid (PubChem CID 120528850) has the molecular formula C15H19NO3S2 and a molecular weight of 325.45 g/mol. Its IUPAC name is 3-[[2-(1,4-dithian-2-yl)acetyl]amino]-2-phenylpropanoic acid.
| Compound Name | 3-[[2-(1,4-dithian-2-yl)acetyl]amino]-2-phenylpropanoic acid |
|---|---|
| PubChem CID | 120528850 |
| Molecular Formula | C15H19NO3S2 |
| Molecular Weight | 325.45 g/mol |
| Exact Mass | 325.08 |
| IUPAC Name | 3-[[2-(1,4-dithian-2-yl)acetyl]amino]-2-phenylpropanoic acid |
| SMILES | O=C(CC1CSCCS1)NCC(C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C15H19NO3S2/c17-14(8-12-10-20-6-7-21-12)16-9-13(15(18)19)11-4-2-1-3-5-11/h1-5,12-13H,6-10H2,(H,16,17)(H,18,19) |
| InChIKey | LIHYFKOOEDHTHP-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.45 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |