C20H26N2O5 — CID 120529097
3-methyl-1-[1-(2-phenoxyacetyl)piperidine-3-carbonyl]pyrrolidine-3-carboxylic acid (PubChem CID 120529097) has the molecular formula C20H26N2O5 and a molecular weight of 374.44 g/mol. Its IUPAC name is 3-methyl-1-[1-(2-phenoxyacetyl)piperidine-3-carbonyl]pyrrolidine-3-carboxylic acid.
| Compound Name | 3-methyl-1-[1-(2-phenoxyacetyl)piperidine-3-carbonyl]pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 120529097 |
| Molecular Formula | C20H26N2O5 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | 3-methyl-1-[1-(2-phenoxyacetyl)piperidine-3-carbonyl]pyrrolidine-3-carboxylic acid |
| SMILES | CC1(C(=O)O)CCN(C(=O)C2CCCN(C(=O)COc3ccccc3)C2)C1 |
| InChI | InChI=1S/C20H26N2O5/c1-20(19(25)26)9-11-22(14-20)18(24)15-6-5-10-21(12-15)17(23)13-27-16-7-3-2-4-8-16/h2-4,7-8,15H,5-6,9-14H2,1H3,(H,25,26) |
| InChIKey | MJLHTGGUYXRXHH-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |