C16H20N2O5S — CID 120529403
3-methyl-1-(5-nitro-2-propan-2-ylsulfanylbenzoyl)pyrrolidine-3-carboxylic acid (PubChem CID 120529403) has the molecular formula C16H20N2O5S and a molecular weight of 352.41 g/mol. Its IUPAC name is 3-methyl-1-(5-nitro-2-propan-2-ylsulfanylbenzoyl)pyrrolidine-3-carboxylic acid.
| Compound Name | 3-methyl-1-(5-nitro-2-propan-2-ylsulfanylbenzoyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 120529403 |
| Molecular Formula | C16H20N2O5S |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | 3-methyl-1-(5-nitro-2-propan-2-ylsulfanylbenzoyl)pyrrolidine-3-carboxylic acid |
| SMILES | CC(C)Sc1ccc([N+](=O)[O-])cc1C(=O)N1CCC(C)(C(=O)O)C1 |
| InChI | InChI=1S/C16H20N2O5S/c1-10(2)24-13-5-4-11(18(22)23)8-12(13)14(19)17-7-6-16(3,9-17)15(20)21/h4-5,8,10H,6-7,9H2,1-3H3,(H,20,21) |
| InChIKey | QKOBCVJAKTYMIB-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 100.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|