C18H24N2O5S — CID 97250314
methyl (3S)-3-methyl-1-[2-(2-methylpropylsulfanyl)-5-nitrobenzoyl]pyrrolidine-3-carboxylate (PubChem CID 97250314) has the molecular formula C18H24N2O5S and a molecular weight of 380.47 g/mol. Its IUPAC name is methyl (3S)-3-methyl-1-[2-(2-methylpropylsulfanyl)-5-nitrobenzoyl]pyrrolidine-3-carboxylate.
| Compound Name | methyl (3S)-3-methyl-1-[2-(2-methylpropylsulfanyl)-5-nitrobenzoyl]pyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 97250314 |
| Molecular Formula | C18H24N2O5S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | methyl (3S)-3-methyl-1-[2-(2-methylpropylsulfanyl)-5-nitrobenzoyl]pyrrolidine-3-carboxylate |
| SMILES | COC(=O)[C@@]1(C)CCN(C(=O)c2cc([N+](=O)[O-])ccc2SCC(C)C)C1 |
| InChI | InChI=1S/C18H24N2O5S/c1-12(2)10-26-15-6-5-13(20(23)24)9-14(15)16(21)19-8-7-18(3,11-19)17(22)25-4/h5-6,9,12H,7-8,10-11H2,1-4H3/t18-/m0/s1 |
| InChIKey | ODEZPQKIXDEIDR-SFHVURJKSA-N |
| XLogP | 3.37 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|