C17H20ClN3O3 — CID 120529915
2-[butan-2-yl-[1-(2-chlorophenyl)-5-methylpyrazole-3-carbonyl]amino]acetic acid (PubChem CID 120529915) has the molecular formula C17H20ClN3O3 and a molecular weight of 349.82 g/mol. Its IUPAC name is 2-[butan-2-yl-[1-(2-chlorophenyl)-5-methylpyrazole-3-carbonyl]amino]acetic acid.
| Compound Name | 2-[butan-2-yl-[1-(2-chlorophenyl)-5-methylpyrazole-3-carbonyl]amino]acetic acid |
|---|---|
| PubChem CID | 120529915 |
| Molecular Formula | C17H20ClN3O3 |
| Molecular Weight | 349.82 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | 2-[butan-2-yl-[1-(2-chlorophenyl)-5-methylpyrazole-3-carbonyl]amino]acetic acid |
| SMILES | CCC(C)N(CC(=O)O)C(=O)c1cc(C)n(-c2ccccc2Cl)n1 |
| InChI | InChI=1S/C17H20ClN3O3/c1-4-11(2)20(10-16(22)23)17(24)14-9-12(3)21(19-14)15-8-6-5-7-13(15)18/h5-9,11H,4,10H2,1-3H3,(H,22,23) |
| InChIKey | ACQDGEUJRHWWMI-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.82 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |