C14H21F3N2O4 — CID 120530140
4-ethyl-1-[[3-oxo-3-(2,2,2-trifluoroethylamino)propanoyl]amino]cyclohexane-1-carboxylic acid (PubChem CID 120530140) has the molecular formula C14H21F3N2O4 and a molecular weight of 338.33 g/mol. Its IUPAC name is 4-ethyl-1-[[3-oxo-3-(2,2,2-trifluoroethylamino)propanoyl]amino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-ethyl-1-[[3-oxo-3-(2,2,2-trifluoroethylamino)propanoyl]amino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 120530140 |
| Molecular Formula | C14H21F3N2O4 |
| Molecular Weight | 338.33 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | 4-ethyl-1-[[3-oxo-3-(2,2,2-trifluoroethylamino)propanoyl]amino]cyclohexane-1-carboxylic acid |
| SMILES | CCC1CCC(NC(=O)CC(=O)NCC(F)(F)F)(C(=O)O)CC1 |
| InChI | InChI=1S/C14H21F3N2O4/c1-2-9-3-5-13(6-4-9,12(22)23)19-11(21)7-10(20)18-8-14(15,16)17/h9H,2-8H2,1H3,(H,18,20)(H,19,21)(H,22,23) |
| InChIKey | KYXJJRNVVXNYGW-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.33 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|