C16H18N2O4S — CID 120530746
4-[4-[(2,5-dimethyl-1,3-thiazole-4-carbonyl)amino]phenoxy]butanoic acid (PubChem CID 120530746) has the molecular formula C16H18N2O4S and a molecular weight of 334.40 g/mol. Its IUPAC name is 4-[4-[(2,5-dimethyl-1,3-thiazole-4-carbonyl)amino]phenoxy]butanoic acid.
| Compound Name | 4-[4-[(2,5-dimethyl-1,3-thiazole-4-carbonyl)amino]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 120530746 |
| Molecular Formula | C16H18N2O4S |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | 4-[4-[(2,5-dimethyl-1,3-thiazole-4-carbonyl)amino]phenoxy]butanoic acid |
| SMILES | Cc1nc(C(=O)Nc2ccc(OCCCC(=O)O)cc2)c(C)s1 |
| InChI | InChI=1S/C16H18N2O4S/c1-10-15(17-11(2)23-10)16(21)18-12-5-7-13(8-6-12)22-9-3-4-14(19)20/h5-8H,3-4,9H2,1-2H3,(H,18,21)(H,19,20) |
| InChIKey | RWWGWRGRMBYCEB-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|