C18H17F3N2O5 — CID 120530778
4-[4-[[2-(2,2,2-trifluoroethoxy)pyridine-4-carbonyl]amino]phenoxy]butanoic acid (PubChem CID 120530778) has the molecular formula C18H17F3N2O5 and a molecular weight of 398.34 g/mol. Its IUPAC name is 4-[4-[[2-(2,2,2-trifluoroethoxy)pyridine-4-carbonyl]amino]phenoxy]butanoic acid.
| Compound Name | 4-[4-[[2-(2,2,2-trifluoroethoxy)pyridine-4-carbonyl]amino]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 120530778 |
| Molecular Formula | C18H17F3N2O5 |
| Molecular Weight | 398.34 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | 4-[4-[[2-(2,2,2-trifluoroethoxy)pyridine-4-carbonyl]amino]phenoxy]butanoic acid |
| SMILES | O=C(O)CCCOc1ccc(NC(=O)c2ccnc(OCC(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C18H17F3N2O5/c19-18(20,21)11-28-15-10-12(7-8-22-15)17(26)23-13-3-5-14(6-4-13)27-9-1-2-16(24)25/h3-8,10H,1-2,9,11H2,(H,23,26)(H,24,25) |
| InChIKey | QRDGSTSJICDLGD-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 97.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.34 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|