C16H25N3O3S — CID 120531154
4-[(5-methyl-1-pentan-3-ylpyrazole-3-carbonyl)amino]thiane-4-carboxylic acid (PubChem CID 120531154) has the molecular formula C16H25N3O3S and a molecular weight of 339.46 g/mol. Its IUPAC name is 4-[(5-methyl-1-pentan-3-ylpyrazole-3-carbonyl)amino]thiane-4-carboxylic acid.
| Compound Name | 4-[(5-methyl-1-pentan-3-ylpyrazole-3-carbonyl)amino]thiane-4-carboxylic acid |
|---|---|
| PubChem CID | 120531154 |
| Molecular Formula | C16H25N3O3S |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | 4-[(5-methyl-1-pentan-3-ylpyrazole-3-carbonyl)amino]thiane-4-carboxylic acid |
| SMILES | CCC(CC)n1nc(C(=O)NC2(C(=O)O)CCSCC2)cc1C |
| InChI | InChI=1S/C16H25N3O3S/c1-4-12(5-2)19-11(3)10-13(18-19)14(20)17-16(15(21)22)6-8-23-9-7-16/h10,12H,4-9H2,1-3H3,(H,17,20)(H,21,22) |
| InChIKey | GNUMDOCMFRXIEY-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |