C17H27NO3S — CID 120531246
4-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-2-carbonylamino)thiane-4-carboxylic acid (PubChem CID 120531246) has the molecular formula C17H27NO3S and a molecular weight of 325.47 g/mol. Its IUPAC name is 4-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-2-carbonylamino)thiane-4-carboxylic acid.
| Compound Name | 4-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-2-carbonylamino)thiane-4-carboxylic acid |
|---|---|
| PubChem CID | 120531246 |
| Molecular Formula | C17H27NO3S |
| Molecular Weight | 325.47 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | 4-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-2-carbonylamino)thiane-4-carboxylic acid |
| SMILES | O=C(NC1(C(=O)O)CCSCC1)C1CCC2CCCCC2C1 |
| InChI | InChI=1S/C17H27NO3S/c19-15(18-17(16(20)21)7-9-22-10-8-17)14-6-5-12-3-1-2-4-13(12)11-14/h12-14H,1-11H2,(H,18,19)(H,20,21) |
| InChIKey | CGRVMENMPDMKDV-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.47 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |