C15H18N2O5S — CID 120531425
3-[[2-[(2-phenoxyacetyl)amino]acetyl]amino]thiolane-3-carboxylic acid (PubChem CID 120531425) has the molecular formula C15H18N2O5S and a molecular weight of 338.39 g/mol. Its IUPAC name is 3-[[2-[(2-phenoxyacetyl)amino]acetyl]amino]thiolane-3-carboxylic acid.
| Compound Name | 3-[[2-[(2-phenoxyacetyl)amino]acetyl]amino]thiolane-3-carboxylic acid |
|---|---|
| PubChem CID | 120531425 |
| Molecular Formula | C15H18N2O5S |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | 3-[[2-[(2-phenoxyacetyl)amino]acetyl]amino]thiolane-3-carboxylic acid |
| SMILES | O=C(COc1ccccc1)NCC(=O)NC1(C(=O)O)CCSC1 |
| InChI | InChI=1S/C15H18N2O5S/c18-12(17-15(14(20)21)6-7-23-10-15)8-16-13(19)9-22-11-4-2-1-3-5-11/h1-5H,6-10H2,(H,16,19)(H,17,18)(H,20,21) |
| InChIKey | QODINHNUSAQIBA-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |