C13H16N2O4S2 — CID 120531061
4-[[2-(thiophene-2-carbonylamino)acetyl]amino]thiane-4-carboxylic acid (PubChem CID 120531061) has the molecular formula C13H16N2O4S2 and a molecular weight of 328.42 g/mol. Its IUPAC name is 4-[[2-(thiophene-2-carbonylamino)acetyl]amino]thiane-4-carboxylic acid.
| Compound Name | 4-[[2-(thiophene-2-carbonylamino)acetyl]amino]thiane-4-carboxylic acid |
|---|---|
| PubChem CID | 120531061 |
| Molecular Formula | C13H16N2O4S2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | 4-[[2-(thiophene-2-carbonylamino)acetyl]amino]thiane-4-carboxylic acid |
| SMILES | O=C(CNC(=O)c1cccs1)NC1(C(=O)O)CCSCC1 |
| InChI | InChI=1S/C13H16N2O4S2/c16-10(8-14-11(17)9-2-1-5-21-9)15-13(12(18)19)3-6-20-7-4-13/h1-2,5H,3-4,6-8H2,(H,14,17)(H,15,16)(H,18,19) |
| InChIKey | QYXNUVAMWDMFLH-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |