C19H22N2O5 — CID 120531886
3-methoxy-2-methyl-2-[[2-[3-(pyridin-3-ylmethoxy)phenyl]acetyl]amino]propanoic acid (PubChem CID 120531886) has the molecular formula C19H22N2O5 and a molecular weight of 358.39 g/mol. Its IUPAC name is 3-methoxy-2-methyl-2-[[2-[3-(pyridin-3-ylmethoxy)phenyl]acetyl]amino]propanoic acid.
| Compound Name | 3-methoxy-2-methyl-2-[[2-[3-(pyridin-3-ylmethoxy)phenyl]acetyl]amino]propanoic acid |
|---|---|
| PubChem CID | 120531886 |
| Molecular Formula | C19H22N2O5 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | 3-methoxy-2-methyl-2-[[2-[3-(pyridin-3-ylmethoxy)phenyl]acetyl]amino]propanoic acid |
| SMILES | COCC(C)(NC(=O)Cc1cccc(OCc2cccnc2)c1)C(=O)O |
| InChI | InChI=1S/C19H22N2O5/c1-19(13-25-2,18(23)24)21-17(22)10-14-5-3-7-16(9-14)26-12-15-6-4-8-20-11-15/h3-9,11H,10,12-13H2,1-2H3,(H,21,22)(H,23,24) |
| InChIKey | IPQAMXHUAWLDJA-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 97.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |