C18H20FN3O4 — CID 120533304
2-ethyl-2-[[[1-(2-fluorophenyl)-6-oxopyridazine-3-carbonyl]amino]methyl]butanoic acid (PubChem CID 120533304) has the molecular formula C18H20FN3O4 and a molecular weight of 361.37 g/mol. Its IUPAC name is 2-ethyl-2-[[[1-(2-fluorophenyl)-6-oxopyridazine-3-carbonyl]amino]methyl]butanoic acid.
| Compound Name | 2-ethyl-2-[[[1-(2-fluorophenyl)-6-oxopyridazine-3-carbonyl]amino]methyl]butanoic acid |
|---|---|
| PubChem CID | 120533304 |
| Molecular Formula | C18H20FN3O4 |
| Molecular Weight | 361.37 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | 2-ethyl-2-[[[1-(2-fluorophenyl)-6-oxopyridazine-3-carbonyl]amino]methyl]butanoic acid |
| SMILES | CCC(CC)(CNC(=O)c1ccc(=O)n(-c2ccccc2F)n1)C(=O)O |
| InChI | InChI=1S/C18H20FN3O4/c1-3-18(4-2,17(25)26)11-20-16(24)13-9-10-15(23)22(21-13)14-8-6-5-7-12(14)19/h5-10H,3-4,11H2,1-2H3,(H,20,24)(H,25,26) |
| InChIKey | JJXQPLKVMUAXTE-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.37 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |