C16H16FN3O4 — CID 120516708
3-[ethyl-[1-(2-fluorophenyl)-6-oxopyridazine-3-carbonyl]amino]propanoic acid (PubChem CID 120516708) has the molecular formula C16H16FN3O4 and a molecular weight of 333.32 g/mol. Its IUPAC name is 3-[ethyl-[1-(2-fluorophenyl)-6-oxopyridazine-3-carbonyl]amino]propanoic acid.
| Compound Name | 3-[ethyl-[1-(2-fluorophenyl)-6-oxopyridazine-3-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 120516708 |
| Molecular Formula | C16H16FN3O4 |
| Molecular Weight | 333.32 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | 3-[ethyl-[1-(2-fluorophenyl)-6-oxopyridazine-3-carbonyl]amino]propanoic acid |
| SMILES | CCN(CCC(=O)O)C(=O)c1ccc(=O)n(-c2ccccc2F)n1 |
| InChI | InChI=1S/C16H16FN3O4/c1-2-19(10-9-15(22)23)16(24)12-7-8-14(21)20(18-12)13-6-4-3-5-11(13)17/h3-8H,2,9-10H2,1H3,(H,22,23) |
| InChIKey | IFKPCBAXHIVABI-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.32 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |