C15H26N2O5 — CID 120534260
1-[2-[4-methoxypentanoyl(methyl)amino]acetyl]piperidine-3-carboxylic acid (PubChem CID 120534260) has the molecular formula C15H26N2O5 and a molecular weight of 314.38 g/mol. Its IUPAC name is 1-[2-[4-methoxypentanoyl(methyl)amino]acetyl]piperidine-3-carboxylic acid.
| Compound Name | 1-[2-[4-methoxypentanoyl(methyl)amino]acetyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 120534260 |
| Molecular Formula | C15H26N2O5 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.18 |
| IUPAC Name | 1-[2-[4-methoxypentanoyl(methyl)amino]acetyl]piperidine-3-carboxylic acid |
| SMILES | COC(C)CCC(=O)N(C)CC(=O)N1CCCC(C(=O)O)C1 |
| InChI | InChI=1S/C15H26N2O5/c1-11(22-3)6-7-13(18)16(2)10-14(19)17-8-4-5-12(9-17)15(20)21/h11-12H,4-10H2,1-3H3,(H,20,21) |
| InChIKey | HYBMPQGRVMEHKH-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |