C16H26N2O4 — CID 120689284
1-[2-[2,4-dimethylpent-4-enoyl(methyl)amino]acetyl]piperidine-3-carboxylic acid (PubChem CID 120689284) has the molecular formula C16H26N2O4 and a molecular weight of 310.39 g/mol. Its IUPAC name is 1-[2-[2,4-dimethylpent-4-enoyl(methyl)amino]acetyl]piperidine-3-carboxylic acid.
| Compound Name | 1-[2-[2,4-dimethylpent-4-enoyl(methyl)amino]acetyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 120689284 |
| Molecular Formula | C16H26N2O4 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | 1-[2-[2,4-dimethylpent-4-enoyl(methyl)amino]acetyl]piperidine-3-carboxylic acid |
| SMILES | C=C(C)CC(C)C(=O)N(C)CC(=O)N1CCCC(C(=O)O)C1 |
| InChI | InChI=1S/C16H26N2O4/c1-11(2)8-12(3)15(20)17(4)10-14(19)18-7-5-6-13(9-18)16(21)22/h12-13H,1,5-10H2,2-4H3,(H,21,22) |
| InChIKey | NLVDWHIEMHGLKU-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|