C18H21N3O3 — CID 120535538
3-[2-[(2-cyclopentylpyrazole-3-carbonyl)amino]ethyl]benzoic acid (PubChem CID 120535538) has the molecular formula C18H21N3O3 and a molecular weight of 327.38 g/mol. Its IUPAC name is 3-[2-[(2-cyclopentylpyrazole-3-carbonyl)amino]ethyl]benzoic acid.
| Compound Name | 3-[2-[(2-cyclopentylpyrazole-3-carbonyl)amino]ethyl]benzoic acid |
|---|---|
| PubChem CID | 120535538 |
| Molecular Formula | C18H21N3O3 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | 3-[2-[(2-cyclopentylpyrazole-3-carbonyl)amino]ethyl]benzoic acid |
| SMILES | O=C(O)c1cccc(CCNC(=O)c2ccnn2C2CCCC2)c1 |
| InChI | InChI=1S/C18H21N3O3/c22-17(16-9-11-20-21(16)15-6-1-2-7-15)19-10-8-13-4-3-5-14(12-13)18(23)24/h3-5,9,11-12,15H,1-2,6-8,10H2,(H,19,22)(H,23,24) |
| InChIKey | QRQXSAYFUHIUGV-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |