C19H21NO3S — CID 120537007
3-methyl-4-[(4-methyl-2-phenylsulfanylbenzoyl)amino]butanoic acid (PubChem CID 120537007) has the molecular formula C19H21NO3S and a molecular weight of 343.45 g/mol. Its IUPAC name is 3-methyl-4-[(4-methyl-2-phenylsulfanylbenzoyl)amino]butanoic acid.
| Compound Name | 3-methyl-4-[(4-methyl-2-phenylsulfanylbenzoyl)amino]butanoic acid |
|---|---|
| PubChem CID | 120537007 |
| Molecular Formula | C19H21NO3S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | 3-methyl-4-[(4-methyl-2-phenylsulfanylbenzoyl)amino]butanoic acid |
| SMILES | Cc1ccc(C(=O)NCC(C)CC(=O)O)c(Sc2ccccc2)c1 |
| InChI | InChI=1S/C19H21NO3S/c1-13-8-9-16(19(23)20-12-14(2)11-18(21)22)17(10-13)24-15-6-4-3-5-7-15/h3-10,14H,11-12H2,1-2H3,(H,20,23)(H,21,22) |
| InChIKey | BLOOVNLDFNVBHY-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |