C13H17NO4S — CID 120537327
(2R)-1-[3-(methoxymethyl)thiophene-2-carbonyl]piperidine-2-carboxylic acid (PubChem CID 120537327) has the molecular formula C13H17NO4S and a molecular weight of 283.35 g/mol. Its IUPAC name is (2R)-1-[3-(methoxymethyl)thiophene-2-carbonyl]piperidine-2-carboxylic acid.
| Compound Name | (2R)-1-[3-(methoxymethyl)thiophene-2-carbonyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 120537327 |
| Molecular Formula | C13H17NO4S |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | (2R)-1-[3-(methoxymethyl)thiophene-2-carbonyl]piperidine-2-carboxylic acid |
| SMILES | COCc1ccsc1C(=O)N1CCCC[C@@H]1C(=O)O |
| InChI | InChI=1S/C13H17NO4S/c1-18-8-9-5-7-19-11(9)12(15)14-6-3-2-4-10(14)13(16)17/h5,7,10H,2-4,6,8H2,1H3,(H,16,17)/t10-/m1/s1 |
| InChIKey | JZWBILMDALBXTA-SNVBAGLBSA-N |
| XLogP | 1.97 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |