C15H18INO3 — CID 120539598
1-[(4-iodobenzoyl)-methylamino]cyclohexane-1-carboxylic acid (PubChem CID 120539598) has the molecular formula C15H18INO3 and a molecular weight of 387.22 g/mol. Its IUPAC name is 1-[(4-iodobenzoyl)-methylamino]cyclohexane-1-carboxylic acid.
| Compound Name | 1-[(4-iodobenzoyl)-methylamino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 120539598 |
| Molecular Formula | C15H18INO3 |
| Molecular Weight | 387.22 g/mol |
| Exact Mass | 387.03 |
| IUPAC Name | 1-[(4-iodobenzoyl)-methylamino]cyclohexane-1-carboxylic acid |
| SMILES | CN(C(=O)c1ccc(I)cc1)C1(C(=O)O)CCCCC1 |
| InChI | InChI=1S/C15H18INO3/c1-17(13(18)11-5-7-12(16)8-6-11)15(14(19)20)9-3-2-4-10-15/h5-8H,2-4,9-10H2,1H3,(H,19,20) |
| InChIKey | ZDTBUECAYZVQCW-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.22 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|