1-[(2-iodobenzoyl)-methylamino]cyclohexane-1-carboxylic acid

C15H18INO3 — CID 120539755

IUPAC1-[(2-iodobenzoyl)-methylamino]cyclohexane-1-carboxylic acid
SMILESCN(C(=O)c1ccccc1I)C1(C(=O)O)CCCCC1
InChIInChI=1S/C15H18INO3/c1-17(13(18)11-7-3-4-8-12(11)16)15(14(19)20)9-5-2-6-10-15/h3-4,7-8H,2,5-6,9-10H2,1H3,(H,19,20)
InChIKeyDLJSPXIWMAQRBA-UHFFFAOYSA-N
MW387.22 g/mol
LogP3.15
Rot. Bonds3

About 1-[(2-iodobenzoyl)-methylamino]cyclohexane-1-carboxylic acid

1-[(2-iodobenzoyl)-methylamino]cyclohexane-1-carboxylic acid (PubChem CID 120539755) has the molecular formula C15H18INO3 and a molecular weight of 387.22 g/mol. Its IUPAC name is 1-[(2-iodobenzoyl)-methylamino]cyclohexane-1-carboxylic acid.

Molecular Properties

Compound Name1-[(2-iodobenzoyl)-methylamino]cyclohexane-1-carboxylic acid
PubChem CID120539755
Molecular FormulaC15H18INO3
Molecular Weight387.22 g/mol
Exact Mass387.03
IUPAC Name1-[(2-iodobenzoyl)-methylamino]cyclohexane-1-carboxylic acid
SMILESCN(C(=O)c1ccccc1I)C1(C(=O)O)CCCCC1
InChIInChI=1S/C15H18INO3/c1-17(13(18)11-7-3-4-8-12(11)16)15(14(19)20)9-5-2-6-10-15/h3-4,7-8H,2,5-6,9-10H2,1H3,(H,19,20)
InChIKeyDLJSPXIWMAQRBA-UHFFFAOYSA-N
XLogP3.15
TPSA57.61 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500387.22
LogP ≤ 53.15
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'iodine', 'substructure': 'N/A'}

Analyze 1-[(2-iodobenzoyl)-methylamino]cyclohexane-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-[(2-iodobenzoyl)-methylamino]cyclohexane-1-carboxylic acid?
The IUPAC name of 1-[(2-iodobenzoyl)-methylamino]cyclohexane-1-carboxylic acid (CID 120539755) is 1-[(2-iodobenzoyl)-methylamino]cyclohexane-1-carboxylic acid.
What is the SMILES notation for 1-[(2-iodobenzoyl)-methylamino]cyclohexane-1-carboxylic acid?
The canonical SMILES for 1-[(2-iodobenzoyl)-methylamino]cyclohexane-1-carboxylic acid is CN(C(=O)c1ccccc1I)C1(C(=O)O)CCCCC1.
What is the InChIKey of 1-[(2-iodobenzoyl)-methylamino]cyclohexane-1-carboxylic acid?
The InChIKey is DLJSPXIWMAQRBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18INO3/c1-17(13(18)11-7-3-4-8-12(11)16)15(14(19)20)9-5-2-6-10-15/h3-4,7-8H,2,5-6,9-10H2,1H3,(H,19,20).
What are the key properties of 1-[(2-iodobenzoyl)-methylamino]cyclohexane-1-carboxylic acid?
1-[(2-iodobenzoyl)-methylamino]cyclohexane-1-carboxylic acid has a molecular weight of 387.22 g/mol, XLogP of 3.15, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2-iodobenzoyl)-methylamino]cyclohexane-1-carboxylic acid is sourced from PubChem (CID 120539755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).