C20H28N2O4 — CID 120539890
1-[[3-acetamido-3-(4-methylphenyl)propanoyl]-methylamino]cyclohexane-1-carboxylic acid (PubChem CID 120539890) has the molecular formula C20H28N2O4 and a molecular weight of 360.45 g/mol. Its IUPAC name is 1-[[3-acetamido-3-(4-methylphenyl)propanoyl]-methylamino]cyclohexane-1-carboxylic acid.
| Compound Name | 1-[[3-acetamido-3-(4-methylphenyl)propanoyl]-methylamino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 120539890 |
| Molecular Formula | C20H28N2O4 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | 1-[[3-acetamido-3-(4-methylphenyl)propanoyl]-methylamino]cyclohexane-1-carboxylic acid |
| SMILES | CC(=O)NC(CC(=O)N(C)C1(C(=O)O)CCCCC1)c1ccc(C)cc1 |
| InChI | InChI=1S/C20H28N2O4/c1-14-7-9-16(10-8-14)17(21-15(2)23)13-18(24)22(3)20(19(25)26)11-5-4-6-12-20/h7-10,17H,4-6,11-13H2,1-3H3,(H,21,23)(H,25,26) |
| InChIKey | JXICZQQWLYBQLY-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |