C20H25N3O2 — CID 95585277
(3S)-3-acetamido-N-methyl-3-(4-methylphenyl)-N-[(1R)-1-pyridin-4-ylethyl]propanamide (PubChem CID 95585277) has the molecular formula C20H25N3O2 and a molecular weight of 339.44 g/mol. Its IUPAC name is (3S)-3-acetamido-N-methyl-3-(4-methylphenyl)-N-[(1R)-1-pyridin-4-ylethyl]propanamide.
| Compound Name | (3S)-3-acetamido-N-methyl-3-(4-methylphenyl)-N-[(1R)-1-pyridin-4-ylethyl]propanamide |
|---|---|
| PubChem CID | 95585277 |
| Molecular Formula | C20H25N3O2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.19 |
| IUPAC Name | (3S)-3-acetamido-N-methyl-3-(4-methylphenyl)-N-[(1R)-1-pyridin-4-ylethyl]propanamide |
| SMILES | CC(=O)N[C@@H](CC(=O)N(C)[C@H](C)c1ccncc1)c1ccc(C)cc1 |
| InChI | InChI=1S/C20H25N3O2/c1-14-5-7-18(8-6-14)19(22-16(3)24)13-20(25)23(4)15(2)17-9-11-21-12-10-17/h5-12,15,19H,13H2,1-4H3,(H,22,24)/t15-,19+/m1/s1 |
| InChIKey | SSFDFUZYKCEBPZ-BEFAXECRSA-N |
| XLogP | 3.18 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |