C18H25NO4S — CID 120542342
4-[[[2-(4-propan-2-ylphenyl)sulfanylacetyl]amino]methyl]oxane-4-carboxylic acid (PubChem CID 120542342) has the molecular formula C18H25NO4S and a molecular weight of 351.47 g/mol. Its IUPAC name is 4-[[[2-(4-propan-2-ylphenyl)sulfanylacetyl]amino]methyl]oxane-4-carboxylic acid.
| Compound Name | 4-[[[2-(4-propan-2-ylphenyl)sulfanylacetyl]amino]methyl]oxane-4-carboxylic acid |
|---|---|
| PubChem CID | 120542342 |
| Molecular Formula | C18H25NO4S |
| Molecular Weight | 351.47 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | 4-[[[2-(4-propan-2-ylphenyl)sulfanylacetyl]amino]methyl]oxane-4-carboxylic acid |
| SMILES | CC(C)c1ccc(SCC(=O)NCC2(C(=O)O)CCOCC2)cc1 |
| InChI | InChI=1S/C18H25NO4S/c1-13(2)14-3-5-15(6-4-14)24-11-16(20)19-12-18(17(21)22)7-9-23-10-8-18/h3-6,13H,7-12H2,1-2H3,(H,19,20)(H,21,22) |
| InChIKey | PLCZONMJOZTOGT-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.47 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |