C19H27NO5 — CID 120690092
4-[[3-(4-methoxyphenyl)pentanoylamino]methyl]oxane-4-carboxylic acid (PubChem CID 120690092) has the molecular formula C19H27NO5 and a molecular weight of 349.43 g/mol. Its IUPAC name is 4-[[3-(4-methoxyphenyl)pentanoylamino]methyl]oxane-4-carboxylic acid.
| Compound Name | 4-[[3-(4-methoxyphenyl)pentanoylamino]methyl]oxane-4-carboxylic acid |
|---|---|
| PubChem CID | 120690092 |
| Molecular Formula | C19H27NO5 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | 4-[[3-(4-methoxyphenyl)pentanoylamino]methyl]oxane-4-carboxylic acid |
| SMILES | CCC(CC(=O)NCC1(C(=O)O)CCOCC1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C19H27NO5/c1-3-14(15-4-6-16(24-2)7-5-15)12-17(21)20-13-19(18(22)23)8-10-25-11-9-19/h4-7,14H,3,8-13H2,1-2H3,(H,20,21)(H,22,23) |
| InChIKey | KQJHXERWYOYWTP-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |