C18H25NO5S — CID 120544615
1-[[[2-(4-ethylsulfonylphenyl)acetyl]amino]methyl]cyclohexane-1-carboxylic acid (PubChem CID 120544615) has the molecular formula C18H25NO5S and a molecular weight of 367.47 g/mol. Its IUPAC name is 1-[[[2-(4-ethylsulfonylphenyl)acetyl]amino]methyl]cyclohexane-1-carboxylic acid.
| Compound Name | 1-[[[2-(4-ethylsulfonylphenyl)acetyl]amino]methyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 120544615 |
| Molecular Formula | C18H25NO5S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | 1-[[[2-(4-ethylsulfonylphenyl)acetyl]amino]methyl]cyclohexane-1-carboxylic acid |
| SMILES | CCS(=O)(=O)c1ccc(CC(=O)NCC2(C(=O)O)CCCCC2)cc1 |
| InChI | InChI=1S/C18H25NO5S/c1-2-25(23,24)15-8-6-14(7-9-15)12-16(20)19-13-18(17(21)22)10-4-3-5-11-18/h6-9H,2-5,10-13H2,1H3,(H,19,20)(H,21,22) |
| InChIKey | ORDWFAQKPIIMRR-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |