C19H28N2O5S — CID 120544176
1-[[[4-(diethylsulfamoyl)benzoyl]amino]methyl]cyclohexane-1-carboxylic acid (PubChem CID 120544176) has the molecular formula C19H28N2O5S and a molecular weight of 396.51 g/mol. Its IUPAC name is 1-[[[4-(diethylsulfamoyl)benzoyl]amino]methyl]cyclohexane-1-carboxylic acid.
| Compound Name | 1-[[[4-(diethylsulfamoyl)benzoyl]amino]methyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 120544176 |
| Molecular Formula | C19H28N2O5S |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | 1-[[[4-(diethylsulfamoyl)benzoyl]amino]methyl]cyclohexane-1-carboxylic acid |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(C(=O)NCC2(C(=O)O)CCCCC2)cc1 |
| InChI | InChI=1S/C19H28N2O5S/c1-3-21(4-2)27(25,26)16-10-8-15(9-11-16)17(22)20-14-19(18(23)24)12-6-5-7-13-19/h8-11H,3-7,12-14H2,1-2H3,(H,20,22)(H,23,24) |
| InChIKey | LPZDDICOVORWOO-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |