C23H32N2O4S2 — CID 121179080
4-(diethylsulfamoyl)-N-[[1-[5-(1-hydroxyethyl)thiophen-2-yl]cyclopentyl]methyl]benzamide (PubChem CID 121179080) has the molecular formula C23H32N2O4S2 and a molecular weight of 464.65 g/mol. Its IUPAC name is 4-(diethylsulfamoyl)-N-[[1-[5-(1-hydroxyethyl)thiophen-2-yl]cyclopentyl]methyl]benzamide.
| Compound Name | 4-(diethylsulfamoyl)-N-[[1-[5-(1-hydroxyethyl)thiophen-2-yl]cyclopentyl]methyl]benzamide |
|---|---|
| PubChem CID | 121179080 |
| Molecular Formula | C23H32N2O4S2 |
| Molecular Weight | 464.65 g/mol |
| Exact Mass | 464.18 |
| IUPAC Name | 4-(diethylsulfamoyl)-N-[[1-[5-(1-hydroxyethyl)thiophen-2-yl]cyclopentyl]methyl]benzamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(C(=O)NCC2(c3ccc(C(C)O)s3)CCCC2)cc1 |
| InChI | InChI=1S/C23H32N2O4S2/c1-4-25(5-2)31(28,29)19-10-8-18(9-11-19)22(27)24-16-23(14-6-7-15-23)21-13-12-20(30-21)17(3)26/h8-13,17,26H,4-7,14-16H2,1-3H3,(H,24,27) |
| InChIKey | FCFQGLRSNUVFGU-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.65 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |