C16H25N3O3 — CID 120545169
2-[(5-tert-butyl-1H-pyrazole-3-carbonyl)amino]-2-methylcyclohexane-1-carboxylic acid (PubChem CID 120545169) has the molecular formula C16H25N3O3 and a molecular weight of 307.39 g/mol. Its IUPAC name is 2-[(5-tert-butyl-1H-pyrazole-3-carbonyl)amino]-2-methylcyclohexane-1-carboxylic acid.
| Compound Name | 2-[(5-tert-butyl-1H-pyrazole-3-carbonyl)amino]-2-methylcyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 120545169 |
| Molecular Formula | C16H25N3O3 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.19 |
| IUPAC Name | 2-[(5-tert-butyl-1H-pyrazole-3-carbonyl)amino]-2-methylcyclohexane-1-carboxylic acid |
| SMILES | CC(C)(C)c1cc(C(=O)NC2(C)CCCCC2C(=O)O)n[nH]1 |
| InChI | InChI=1S/C16H25N3O3/c1-15(2,3)12-9-11(18-19-12)13(20)17-16(4)8-6-5-7-10(16)14(21)22/h9-10H,5-8H2,1-4H3,(H,17,20)(H,18,19)(H,21,22) |
| InChIKey | LPVRPPKDANFUSN-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |