C14H19N3O4 — CID 120545640
2-methyl-2-[(1-methyl-6-oxopyridazine-3-carbonyl)amino]cyclohexane-1-carboxylic acid (PubChem CID 120545640) has the molecular formula C14H19N3O4 and a molecular weight of 293.32 g/mol. Its IUPAC name is 2-methyl-2-[(1-methyl-6-oxopyridazine-3-carbonyl)amino]cyclohexane-1-carboxylic acid.
| Compound Name | 2-methyl-2-[(1-methyl-6-oxopyridazine-3-carbonyl)amino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 120545640 |
| Molecular Formula | C14H19N3O4 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 2-methyl-2-[(1-methyl-6-oxopyridazine-3-carbonyl)amino]cyclohexane-1-carboxylic acid |
| SMILES | Cn1nc(C(=O)NC2(C)CCCCC2C(=O)O)ccc1=O |
| InChI | InChI=1S/C14H19N3O4/c1-14(8-4-3-5-9(14)13(20)21)15-12(19)10-6-7-11(18)17(2)16-10/h6-7,9H,3-5,8H2,1-2H3,(H,15,19)(H,20,21) |
| InChIKey | VLZXQJXUZOBKGR-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |