C16H24N4O5 — CID 120545195
2-[3-(3,5-dimethyl-4-nitropyrazol-1-yl)propanoylamino]-2-methylcyclohexane-1-carboxylic acid (PubChem CID 120545195) has the molecular formula C16H24N4O5 and a molecular weight of 352.39 g/mol. Its IUPAC name is 2-[3-(3,5-dimethyl-4-nitropyrazol-1-yl)propanoylamino]-2-methylcyclohexane-1-carboxylic acid.
| Compound Name | 2-[3-(3,5-dimethyl-4-nitropyrazol-1-yl)propanoylamino]-2-methylcyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 120545195 |
| Molecular Formula | C16H24N4O5 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | 2-[3-(3,5-dimethyl-4-nitropyrazol-1-yl)propanoylamino]-2-methylcyclohexane-1-carboxylic acid |
| SMILES | Cc1nn(CCC(=O)NC2(C)CCCCC2C(=O)O)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C16H24N4O5/c1-10-14(20(24)25)11(2)19(18-10)9-7-13(21)17-16(3)8-5-4-6-12(16)15(22)23/h12H,4-9H2,1-3H3,(H,17,21)(H,22,23) |
| InChIKey | DQTPLSMFJQZLGP-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 127.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|