C18H19N3O3S — CID 120546740
4-[(2-imidazo[2,1-b][1,3]thiazol-3-ylacetyl)amino]-5-phenylpentanoic acid (PubChem CID 120546740) has the molecular formula C18H19N3O3S and a molecular weight of 357.44 g/mol. Its IUPAC name is 4-[(2-imidazo[2,1-b][1,3]thiazol-3-ylacetyl)amino]-5-phenylpentanoic acid.
| Compound Name | 4-[(2-imidazo[2,1-b][1,3]thiazol-3-ylacetyl)amino]-5-phenylpentanoic acid |
|---|---|
| PubChem CID | 120546740 |
| Molecular Formula | C18H19N3O3S |
| Molecular Weight | 357.44 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | 4-[(2-imidazo[2,1-b][1,3]thiazol-3-ylacetyl)amino]-5-phenylpentanoic acid |
| SMILES | O=C(O)CCC(Cc1ccccc1)NC(=O)Cc1csc2nccn12 |
| InChI | InChI=1S/C18H19N3O3S/c22-16(11-15-12-25-18-19-8-9-21(15)18)20-14(6-7-17(23)24)10-13-4-2-1-3-5-13/h1-5,8-9,12,14H,6-7,10-11H2,(H,20,22)(H,23,24) |
| InChIKey | SHTDGZRVCKJYNA-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 83.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.44 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |