C14H25NO6S — CID 120548878
2-(oxan-3-yl)-2-[(2-pentylsulfonylacetyl)amino]acetic acid (PubChem CID 120548878) has the molecular formula C14H25NO6S and a molecular weight of 335.42 g/mol. Its IUPAC name is 2-(oxan-3-yl)-2-[(2-pentylsulfonylacetyl)amino]acetic acid.
| Compound Name | 2-(oxan-3-yl)-2-[(2-pentylsulfonylacetyl)amino]acetic acid |
|---|---|
| PubChem CID | 120548878 |
| Molecular Formula | C14H25NO6S |
| Molecular Weight | 335.42 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | 2-(oxan-3-yl)-2-[(2-pentylsulfonylacetyl)amino]acetic acid |
| SMILES | CCCCCS(=O)(=O)CC(=O)NC(C(=O)O)C1CCCOC1 |
| InChI | InChI=1S/C14H25NO6S/c1-2-3-4-8-22(19,20)10-12(16)15-13(14(17)18)11-6-5-7-21-9-11/h11,13H,2-10H2,1H3,(H,15,16)(H,17,18) |
| InChIKey | LJJKNWYNRXDZGM-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.42 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|