C17H21N3O3 — CID 120553949
2-(5-methyl-1,3-dioxoisoindol-2-yl)-N-(3-methylpiperidin-4-yl)acetamide (PubChem CID 120553949) has the molecular formula C17H21N3O3 and a molecular weight of 315.37 g/mol. Its IUPAC name is 2-(5-methyl-1,3-dioxoisoindol-2-yl)-N-(3-methylpiperidin-4-yl)acetamide.
| Compound Name | 2-(5-methyl-1,3-dioxoisoindol-2-yl)-N-(3-methylpiperidin-4-yl)acetamide |
|---|---|
| PubChem CID | 120553949 |
| Molecular Formula | C17H21N3O3 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | 2-(5-methyl-1,3-dioxoisoindol-2-yl)-N-(3-methylpiperidin-4-yl)acetamide |
| SMILES | Cc1ccc2c(c1)C(=O)N(CC(=O)NC1CCNCC1C)C2=O |
| InChI | InChI=1S/C17H21N3O3/c1-10-3-4-12-13(7-10)17(23)20(16(12)22)9-15(21)19-14-5-6-18-8-11(14)2/h3-4,7,11,14,18H,5-6,8-9H2,1-2H3,(H,19,21) |
| InChIKey | AIAZDXFHNSRVIT-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|