C16H26Cl2N4O2 — CID 120554046
N-(3-methylpiperidin-4-yl)-2-morpholin-4-ylpyridine-3-carboxamide;dihydrochloride (PubChem CID 120554046) has the molecular formula C16H26Cl2N4O2 and a molecular weight of 377.32 g/mol. Its IUPAC name is N-(3-methylpiperidin-4-yl)-2-morpholin-4-ylpyridine-3-carboxamide;dihydrochloride.
| Compound Name | N-(3-methylpiperidin-4-yl)-2-morpholin-4-ylpyridine-3-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 120554046 |
| Molecular Formula | C16H26Cl2N4O2 |
| Molecular Weight | 377.32 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | N-(3-methylpiperidin-4-yl)-2-morpholin-4-ylpyridine-3-carboxamide;dihydrochloride |
| SMILES | CC1CNCCC1NC(=O)c1cccnc1N1CCOCC1.Cl.Cl |
| InChI | InChI=1S/C16H24N4O2.2ClH/c1-12-11-17-6-4-14(12)19-16(21)13-3-2-5-18-15(13)20-7-9-22-10-8-20;;/h2-3,5,12,14,17H,4,6-11H2,1H3,(H,19,21);2*1H |
| InChIKey | FVRNZFRFUSRTAY-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.32 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |