C16H26Cl2N4O2 — CID 119602673
N-[2-(aminomethyl)cyclopentyl]-2-morpholin-4-ylpyridine-3-carboxamide;dihydrochloride (PubChem CID 119602673) has the molecular formula C16H26Cl2N4O2 and a molecular weight of 377.32 g/mol. Its IUPAC name is N-[2-(aminomethyl)cyclopentyl]-2-morpholin-4-ylpyridine-3-carboxamide;dihydrochloride.
| Compound Name | N-[2-(aminomethyl)cyclopentyl]-2-morpholin-4-ylpyridine-3-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119602673 |
| Molecular Formula | C16H26Cl2N4O2 |
| Molecular Weight | 377.32 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | N-[2-(aminomethyl)cyclopentyl]-2-morpholin-4-ylpyridine-3-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.NCC1CCCC1NC(=O)c1cccnc1N1CCOCC1 |
| InChI | InChI=1S/C16H24N4O2.2ClH/c17-11-12-3-1-5-14(12)19-16(21)13-4-2-6-18-15(13)20-7-9-22-10-8-20;;/h2,4,6,12,14H,1,3,5,7-11,17H2,(H,19,21);2*1H |
| InChIKey | UNVRZIQWCVWZSL-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.32 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |