C17H24ClF3N2O — CID 120554725
N-(3-methylpiperidin-4-yl)-2-[3-(trifluoromethyl)phenyl]butanamide;hydrochloride (PubChem CID 120554725) has the molecular formula C17H24ClF3N2O and a molecular weight of 364.84 g/mol. Its IUPAC name is N-(3-methylpiperidin-4-yl)-2-[3-(trifluoromethyl)phenyl]butanamide;hydrochloride.
| Compound Name | N-(3-methylpiperidin-4-yl)-2-[3-(trifluoromethyl)phenyl]butanamide;hydrochloride |
|---|---|
| PubChem CID | 120554725 |
| Molecular Formula | C17H24ClF3N2O |
| Molecular Weight | 364.84 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | N-(3-methylpiperidin-4-yl)-2-[3-(trifluoromethyl)phenyl]butanamide;hydrochloride |
| SMILES | CCC(C(=O)NC1CCNCC1C)c1cccc(C(F)(F)F)c1.Cl |
| InChI | InChI=1S/C17H23F3N2O.ClH/c1-3-14(12-5-4-6-13(9-12)17(18,19)20)16(23)22-15-7-8-21-10-11(15)2;/h4-6,9,11,14-15,21H,3,7-8,10H2,1-2H3,(H,22,23);1H |
| InChIKey | VLKPCSSDLGBWME-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.84 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |