C12H16F3N5O — CID 134068455
N-(tetrazolidin-5-yl)-2-[3-(trifluoromethyl)phenyl]butanamide (PubChem CID 134068455) has the molecular formula C12H16F3N5O and a molecular weight of 303.29 g/mol. Its IUPAC name is N-(tetrazolidin-5-yl)-2-[3-(trifluoromethyl)phenyl]butanamide.
| Compound Name | N-(tetrazolidin-5-yl)-2-[3-(trifluoromethyl)phenyl]butanamide |
|---|---|
| PubChem CID | 134068455 |
| Molecular Formula | C12H16F3N5O |
| Molecular Weight | 303.29 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | N-(tetrazolidin-5-yl)-2-[3-(trifluoromethyl)phenyl]butanamide |
| SMILES | CCC(C(=O)NC1NNNN1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H16F3N5O/c1-2-9(10(21)16-11-17-19-20-18-11)7-4-3-5-8(6-7)12(13,14)15/h3-6,9,11,17-20H,2H2,1H3,(H,16,21) |
| InChIKey | WGZPYYYEKMSAGD-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 77.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.29 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |